C19H29N3O3 — CID 67417456
tert-butyl N-[[3-[ethyl(pyrrolidin-1-yl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 67417456) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is tert-butyl N-[[3-[ethyl(pyrrolidin-1-yl)carbamoyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-[ethyl(pyrrolidin-1-yl)carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 67417456 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | tert-butyl N-[[3-[ethyl(pyrrolidin-1-yl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | CCN(C(=O)c1cccc(CNC(=O)OC(C)(C)C)c1)N1CCCC1 |
| InChI | InChI=1S/C19H29N3O3/c1-5-22(21-11-6-7-12-21)17(23)16-10-8-9-15(13-16)14-20-18(24)25-19(2,3)4/h8-10,13H,5-7,11-12,14H2,1-4H3,(H,20,24) |
| InChIKey | DXQKKMPTTPLUKB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |