C14H19BrN2O — CID 67417814
(8bS)-5-bromo-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole (PubChem CID 67417814) has the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. Its IUPAC name is (8bS)-5-bromo-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole.
| Compound Name | (8bS)-5-bromo-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
|---|---|
| PubChem CID | 67417814 |
| Molecular Formula | C14H19BrN2O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | (8bS)-5-bromo-7-methoxy-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indole |
| SMILES | COc1cc(Br)c2c(c1)[C@]1(C)CCN(C)C1N2C |
| InChI | InChI=1S/C14H19BrN2O/c1-14-5-6-16(2)13(14)17(3)12-10(14)7-9(18-4)8-11(12)15/h7-8,13H,5-6H2,1-4H3/t13?,14-/m0/s1 |
| InChIKey | PAKVUGZUEFDQCZ-KZUDCZAMSA-N |
| XLogP | 2.83 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|