About 1-cyclopenta-2,4-dien-1-yl-1-methoxypentan-2-one
1-cyclopenta-2,4-dien-1-yl-1-methoxypentan-2-one (PubChem CID 67418033) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-1-methoxypentan-2-one.
Molecular Properties
| Compound Name | 1-cyclopenta-2,4-dien-1-yl-1-methoxypentan-2-one |
| PubChem CID | 67418033 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-yl-1-methoxypentan-2-one |
| SMILES | CCCC(=O)C(OC)C1C=CC=C1 |
| InChI | InChI=1S/C11H16O2/c1-3-6-10(12)11(13-2)9-7-4-5-8-9/h4-5,7-9,11H,3,6H2,1-2H3 |
| InChIKey | SDKAFCLOGCZESG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopenta-2,4-dien-1-yl-1-methoxypentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-2,4-dien-1-yl-1-methoxypentan-2-one?
The IUPAC name of 1-cyclopenta-2,4-dien-1-yl-1-methoxypentan-2-one (CID 67418033) is 1-cyclopenta-2,4-dien-1-yl-1-methoxypentan-2-one.
What is the SMILES notation for 1-cyclopenta-2,4-dien-1-yl-1-methoxypentan-2-one?
The canonical SMILES for 1-cyclopenta-2,4-dien-1-yl-1-methoxypentan-2-one is CCCC(=O)C(OC)C1C=CC=C1.
What is the InChIKey of 1-cyclopenta-2,4-dien-1-yl-1-methoxypentan-2-one?
The InChIKey is SDKAFCLOGCZESG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-3-6-10(12)11(13-2)9-7-4-5-8-9/h4-5,7-9,11H,3,6H2,1-2H3.
What are the key properties of 1-cyclopenta-2,4-dien-1-yl-1-methoxypentan-2-one?
1-cyclopenta-2,4-dien-1-yl-1-methoxypentan-2-one has a molecular weight of 180.25 g/mol, XLogP of 2.11, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-2,4-dien-1-yl-1-methoxypentan-2-one is sourced from PubChem (CID 67418033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).