C24H28F3N5O3 — CID 67418376
[6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazin-3-yl] N-(4-cyclopropylbutyl)carbamate (PubChem CID 67418376) has the molecular formula C24H28F3N5O3 and a molecular weight of 491.51 g/mol. Its IUPAC name is [6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazin-3-yl] N-(4-cyclopropylbutyl)carbamate.
| Compound Name | [6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazin-3-yl] N-(4-cyclopropylbutyl)carbamate |
|---|---|
| PubChem CID | 67418376 |
| Molecular Formula | C24H28F3N5O3 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | [6-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]pyridazin-3-yl] N-(4-cyclopropylbutyl)carbamate |
| SMILES | O=C(NCCCCC1CC1)Oc1ccc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)nn1 |
| InChI | InChI=1S/C24H28F3N5O3/c25-24(26,27)19-7-2-1-6-18(19)22(33)32-15-13-31(14-16-32)20-10-11-21(30-29-20)35-23(34)28-12-4-3-5-17-8-9-17/h1-2,6-7,10-11,17H,3-5,8-9,12-16H2,(H,28,34) |
| InChIKey | IHAMCMPZRDJSQC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|