C22H22N6O2 — CID 67418383
[4-[5-amino-6-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]-1,2,3,6-tetrahydropyridin-6-yl]-cyclobutylmethanone (PubChem CID 67418383) has the molecular formula C22H22N6O2 and a molecular weight of 402.46 g/mol. Its IUPAC name is [4-[5-amino-6-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]-1,2,3,6-tetrahydropyridin-6-yl]-cyclobutylmethanone.
| Compound Name | [4-[5-amino-6-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]-1,2,3,6-tetrahydropyridin-6-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 67418383 |
| Molecular Formula | C22H22N6O2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | [4-[5-amino-6-(5-phenyl-1,3,4-oxadiazol-2-yl)pyrazin-2-yl]-1,2,3,6-tetrahydropyridin-6-yl]-cyclobutylmethanone |
| SMILES | Nc1ncc(C2=CC(C(=O)C3CCC3)NCC2)nc1-c1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C22H22N6O2/c23-20-18(22-28-27-21(30-22)14-5-2-1-3-6-14)26-17(12-25-20)15-9-10-24-16(11-15)19(29)13-7-4-8-13/h1-3,5-6,11-13,16,24H,4,7-10H2,(H2,23,25) |
| InChIKey | YRUOQFZTSDEZNS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |