C29H29F3N2O3 — CID 67418765
benzyl 4-[ethyl-[3-(trifluoromethyl)phenyl]carbamoyl]-4-phenylpiperidine-1-carboxylate (PubChem CID 67418765) has the molecular formula C29H29F3N2O3 and a molecular weight of 510.56 g/mol. Its IUPAC name is benzyl 4-[ethyl-[3-(trifluoromethyl)phenyl]carbamoyl]-4-phenylpiperidine-1-carboxylate.
| Compound Name | benzyl 4-[ethyl-[3-(trifluoromethyl)phenyl]carbamoyl]-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 67418765 |
| Molecular Formula | C29H29F3N2O3 |
| Molecular Weight | 510.56 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | benzyl 4-[ethyl-[3-(trifluoromethyl)phenyl]carbamoyl]-4-phenylpiperidine-1-carboxylate |
| SMILES | CCN(C(=O)C1(c2ccccc2)CCN(C(=O)OCc2ccccc2)CC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H29F3N2O3/c1-2-34(25-15-9-14-24(20-25)29(30,31)32)26(35)28(23-12-7-4-8-13-23)16-18-33(19-17-28)27(36)37-21-22-10-5-3-6-11-22/h3-15,20H,2,16-19,21H2,1H3 |
| InChIKey | HWSCNWYVZNSPJT-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |