C29H31FN2O3 — CID 67419580
benzyl 4-[2-(N-ethyl-2-fluoroanilino)-2-oxoethyl]-4-phenylpiperidine-1-carboxylate (PubChem CID 67419580) has the molecular formula C29H31FN2O3 and a molecular weight of 474.58 g/mol. Its IUPAC name is benzyl 4-[2-(N-ethyl-2-fluoroanilino)-2-oxoethyl]-4-phenylpiperidine-1-carboxylate.
| Compound Name | benzyl 4-[2-(N-ethyl-2-fluoroanilino)-2-oxoethyl]-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 67419580 |
| Molecular Formula | C29H31FN2O3 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | benzyl 4-[2-(N-ethyl-2-fluoroanilino)-2-oxoethyl]-4-phenylpiperidine-1-carboxylate |
| SMILES | CCN(C(=O)CC1(c2ccccc2)CCN(C(=O)OCc2ccccc2)CC1)c1ccccc1F |
| InChI | InChI=1S/C29H31FN2O3/c1-2-32(26-16-10-9-15-25(26)30)27(33)21-29(24-13-7-4-8-14-24)17-19-31(20-18-29)28(34)35-22-23-11-5-3-6-12-23/h3-16H,2,17-22H2,1H3 |
| InChIKey | VIMYTKDUQIFKQN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |