3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid

C10H12O2 — CID 67419583

IUPAC3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid
SMILESCC(=CC1=CCC=CC1)C(=O)O
InChIInChI=1S/C10H12O2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h2-3,6-7H,4-5H2,1H3,(H,11,12)
InChIKeyYCSKWSYHBMUCIU-UHFFFAOYSA-N
MW164.20 g/mol
LogP2.29
Rot. Bonds2

About 3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid

3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid (PubChem CID 67419583) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid.

Molecular Properties

Compound Name3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid
PubChem CID67419583
Molecular FormulaC10H12O2
Molecular Weight164.20 g/mol
Exact Mass164.08
IUPAC Name3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid
SMILESCC(=CC1=CCC=CC1)C(=O)O
InChIInChI=1S/C10H12O2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h2-3,6-7H,4-5H2,1H3,(H,11,12)
InChIKeyYCSKWSYHBMUCIU-UHFFFAOYSA-N
XLogP2.29
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.20
LogP ≤ 52.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid?
The IUPAC name of 3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid (CID 67419583) is 3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid.
What is the SMILES notation for 3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid?
The canonical SMILES for 3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid is CC(=CC1=CCC=CC1)C(=O)O.
What is the InChIKey of 3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid?
The InChIKey is YCSKWSYHBMUCIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h2-3,6-7H,4-5H2,1H3,(H,11,12).
What are the key properties of 3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid?
3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid has a molecular weight of 164.20 g/mol, XLogP of 2.29, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,4-dien-1-yl-2-methylprop-2-enoic acid is sourced from PubChem (CID 67419583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).