About 1-butoxypropan-2-yl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate
1-butoxypropan-2-yl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate (PubChem CID 67419734) has the molecular formula C15H22ClN3O3
and a molecular weight of 327.81 g/mol. Its IUPAC name is 1-butoxypropan-2-yl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate.
Molecular Properties
| Compound Name | 1-butoxypropan-2-yl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate |
| PubChem CID | 67419734 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-butoxypropan-2-yl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate |
| SMILES | CCCCOCC(C)OC(=O)c1nc(C2CC2)nc(N)c1Cl |
| InChI | InChI=1S/C15H22ClN3O3/c1-3-4-7-21-8-9(2)22-15(20)12-11(16)13(17)19-14(18-12)10-5-6-10/h9-10H,3-8H2,1-2H3,(H2,17,18,19) |
| InChIKey | BJQDYHYTWDPPIV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxypropan-2-yl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxypropan-2-yl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate?
The IUPAC name of 1-butoxypropan-2-yl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate (CID 67419734) is 1-butoxypropan-2-yl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate.
What is the SMILES notation for 1-butoxypropan-2-yl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate?
The canonical SMILES for 1-butoxypropan-2-yl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate is CCCCOCC(C)OC(=O)c1nc(C2CC2)nc(N)c1Cl.
What is the InChIKey of 1-butoxypropan-2-yl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate?
The InChIKey is BJQDYHYTWDPPIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22ClN3O3/c1-3-4-7-21-8-9(2)22-15(20)12-11(16)13(17)19-14(18-12)10-5-6-10/h9-10H,3-8H2,1-2H3,(H2,17,18,19).
What are the key properties of 1-butoxypropan-2-yl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate?
1-butoxypropan-2-yl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate has a molecular weight of 327.81 g/mol, XLogP of 2.95, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxypropan-2-yl 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate is sourced from PubChem (CID 67419734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).