About [4-amino-3,5-dichloro-6-(4-methoxyphenyl)-2-pyridinyl] hydrogen carbonate
[4-amino-3,5-dichloro-6-(4-methoxyphenyl)-2-pyridinyl] hydrogen carbonate (PubChem CID 67419978) has the molecular formula C13H10Cl2N2O4
and a molecular weight of 329.14 g/mol. Its IUPAC name is [4-amino-3,5-dichloro-6-(4-methoxyphenyl)-2-pyridinyl] hydrogen carbonate.
Molecular Properties
| Compound Name | [4-amino-3,5-dichloro-6-(4-methoxyphenyl)-2-pyridinyl] hydrogen carbonate |
| PubChem CID | 67419978 |
| Molecular Formula | C13H10Cl2N2O4 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | [4-amino-3,5-dichloro-6-(4-methoxyphenyl)-2-pyridinyl] hydrogen carbonate |
| SMILES | COc1ccc(-c2nc(OC(=O)O)c(Cl)c(N)c2Cl)cc1 |
| InChI | InChI=1S/C13H10Cl2N2O4/c1-20-7-4-2-6(3-5-7)11-8(14)10(16)9(15)12(17-11)21-13(18)19/h2-5H,1H3,(H2,16,17)(H,18,19) |
| InChIKey | IYEQAPCZFBRBSZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-amino-3,5-dichloro-6-(4-methoxyphenyl)-2-pyridinyl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-amino-3,5-dichloro-6-(4-methoxyphenyl)-2-pyridinyl] hydrogen carbonate?
The IUPAC name of [4-amino-3,5-dichloro-6-(4-methoxyphenyl)-2-pyridinyl] hydrogen carbonate (CID 67419978) is [4-amino-3,5-dichloro-6-(4-methoxyphenyl)-2-pyridinyl] hydrogen carbonate.
What is the SMILES notation for [4-amino-3,5-dichloro-6-(4-methoxyphenyl)-2-pyridinyl] hydrogen carbonate?
The canonical SMILES for [4-amino-3,5-dichloro-6-(4-methoxyphenyl)-2-pyridinyl] hydrogen carbonate is COc1ccc(-c2nc(OC(=O)O)c(Cl)c(N)c2Cl)cc1.
What is the InChIKey of [4-amino-3,5-dichloro-6-(4-methoxyphenyl)-2-pyridinyl] hydrogen carbonate?
The InChIKey is IYEQAPCZFBRBSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2N2O4/c1-20-7-4-2-6(3-5-7)11-8(14)10(16)9(15)12(17-11)21-13(18)19/h2-5H,1H3,(H2,16,17)(H,18,19).
What are the key properties of [4-amino-3,5-dichloro-6-(4-methoxyphenyl)-2-pyridinyl] hydrogen carbonate?
[4-amino-3,5-dichloro-6-(4-methoxyphenyl)-2-pyridinyl] hydrogen carbonate has a molecular weight of 329.14 g/mol, XLogP of 3.70, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-amino-3,5-dichloro-6-(4-methoxyphenyl)-2-pyridinyl] hydrogen carbonate is sourced from PubChem (CID 67419978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).