About 1-methoxy-1-(2-methylcyclopenta-2,4-dien-1-yl)heptan-2-one
1-methoxy-1-(2-methylcyclopenta-2,4-dien-1-yl)heptan-2-one (PubChem CID 67419994) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-methoxy-1-(2-methylcyclopenta-2,4-dien-1-yl)heptan-2-one.
Molecular Properties
| Compound Name | 1-methoxy-1-(2-methylcyclopenta-2,4-dien-1-yl)heptan-2-one |
| PubChem CID | 67419994 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-methoxy-1-(2-methylcyclopenta-2,4-dien-1-yl)heptan-2-one |
| SMILES | CCCCCC(=O)C(OC)C1C=CC=C1C |
| InChI | InChI=1S/C14H22O2/c1-4-5-6-10-13(15)14(16-3)12-9-7-8-11(12)2/h7-9,12,14H,4-6,10H2,1-3H3 |
| InChIKey | OZNFUYXZYMDGFB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-1-(2-methylcyclopenta-2,4-dien-1-yl)heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-1-(2-methylcyclopenta-2,4-dien-1-yl)heptan-2-one?
The IUPAC name of 1-methoxy-1-(2-methylcyclopenta-2,4-dien-1-yl)heptan-2-one (CID 67419994) is 1-methoxy-1-(2-methylcyclopenta-2,4-dien-1-yl)heptan-2-one.
What is the SMILES notation for 1-methoxy-1-(2-methylcyclopenta-2,4-dien-1-yl)heptan-2-one?
The canonical SMILES for 1-methoxy-1-(2-methylcyclopenta-2,4-dien-1-yl)heptan-2-one is CCCCCC(=O)C(OC)C1C=CC=C1C.
What is the InChIKey of 1-methoxy-1-(2-methylcyclopenta-2,4-dien-1-yl)heptan-2-one?
The InChIKey is OZNFUYXZYMDGFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-4-5-6-10-13(15)14(16-3)12-9-7-8-11(12)2/h7-9,12,14H,4-6,10H2,1-3H3.
What are the key properties of 1-methoxy-1-(2-methylcyclopenta-2,4-dien-1-yl)heptan-2-one?
1-methoxy-1-(2-methylcyclopenta-2,4-dien-1-yl)heptan-2-one has a molecular weight of 222.33 g/mol, XLogP of 3.28, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-1-(2-methylcyclopenta-2,4-dien-1-yl)heptan-2-one is sourced from PubChem (CID 67419994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).