C16H26O6S — CID 67420045
[(3aS,4R,6R,7R,7aS)-6-ethylsulfanyl-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] 4-oxopentanoate (PubChem CID 67420045) has the molecular formula C16H26O6S and a molecular weight of 346.45 g/mol. Its IUPAC name is [(3aS,4R,6R,7R,7aS)-6-ethylsulfanyl-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] 4-oxopentanoate.
| Compound Name | [(3aS,4R,6R,7R,7aS)-6-ethylsulfanyl-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] 4-oxopentanoate |
|---|---|
| PubChem CID | 67420045 |
| Molecular Formula | C16H26O6S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | [(3aS,4R,6R,7R,7aS)-6-ethylsulfanyl-2,2,4-trimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl] 4-oxopentanoate |
| SMILES | CCS[C@H]1O[C@H](C)[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC(=O)CCC(C)=O |
| InChI | InChI=1S/C16H26O6S/c1-6-23-15-14(20-11(18)8-7-9(2)17)13-12(10(3)19-15)21-16(4,5)22-13/h10,12-15H,6-8H2,1-5H3/t10-,12+,13+,14-,15-/m1/s1 |
| InChIKey | KMAKHHQAXPTVOG-BGNCJLHMSA-N |
| XLogP | 2.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |