C22H27Cl2FN2O2 — CID 67420299
3-chloro-6-(4-chlorophenyl)-4-(decylamino)-5-fluoropyridine-2-carboxylic acid (PubChem CID 67420299) has the molecular formula C22H27Cl2FN2O2 and a molecular weight of 441.37 g/mol. Its IUPAC name is 3-chloro-6-(4-chlorophenyl)-4-(decylamino)-5-fluoropyridine-2-carboxylic acid.
| Compound Name | 3-chloro-6-(4-chlorophenyl)-4-(decylamino)-5-fluoropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 67420299 |
| Molecular Formula | C22H27Cl2FN2O2 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 3-chloro-6-(4-chlorophenyl)-4-(decylamino)-5-fluoropyridine-2-carboxylic acid |
| SMILES | CCCCCCCCCCNc1c(F)c(-c2ccc(Cl)cc2)nc(C(=O)O)c1Cl |
| InChI | InChI=1S/C22H27Cl2FN2O2/c1-2-3-4-5-6-7-8-9-14-26-20-17(24)21(22(28)29)27-19(18(20)25)15-10-12-16(23)13-11-15/h10-13H,2-9,14H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | MBDCMVQOJCNVIA-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|