About tert-butyl (2R,6S)-4-fluoro-2,6-bis(3-methyl-2-pyridinyl)piperidine-1-carboxylate
tert-butyl (2R,6S)-4-fluoro-2,6-bis(3-methyl-2-pyridinyl)piperidine-1-carboxylate (PubChem CID 67420335) has the molecular formula C22H28FN3O2
and a molecular weight of 385.48 g/mol. Its IUPAC name is tert-butyl (2R,6S)-4-fluoro-2,6-bis(3-methyl-2-pyridinyl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2R,6S)-4-fluoro-2,6-bis(3-methyl-2-pyridinyl)piperidine-1-carboxylate |
| PubChem CID | 67420335 |
| Molecular Formula | C22H28FN3O2 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | tert-butyl (2R,6S)-4-fluoro-2,6-bis(3-methyl-2-pyridinyl)piperidine-1-carboxylate |
| SMILES | Cc1cccnc1[C@H]1CC(F)C[C@@H](c2ncccc2C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H28FN3O2/c1-14-8-6-10-24-19(14)17-12-16(23)13-18(20-15(2)9-7-11-25-20)26(17)21(27)28-22(3,4)5/h6-11,16-18H,12-13H2,1-5H3/t16?,17-,18+ |
| InChIKey | LVSJOHGAGNTIHM-AYHJJNSGSA-N |
| XLogP | 5.24 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (2R,6S)-4-fluoro-2,6-bis(3-methyl-2-pyridinyl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R,6S)-4-fluoro-2,6-bis(3-methyl-2-pyridinyl)piperidine-1-carboxylate?
The IUPAC name of tert-butyl (2R,6S)-4-fluoro-2,6-bis(3-methyl-2-pyridinyl)piperidine-1-carboxylate (CID 67420335) is tert-butyl (2R,6S)-4-fluoro-2,6-bis(3-methyl-2-pyridinyl)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2R,6S)-4-fluoro-2,6-bis(3-methyl-2-pyridinyl)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl (2R,6S)-4-fluoro-2,6-bis(3-methyl-2-pyridinyl)piperidine-1-carboxylate is Cc1cccnc1[C@H]1CC(F)C[C@@H](c2ncccc2C)N1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2R,6S)-4-fluoro-2,6-bis(3-methyl-2-pyridinyl)piperidine-1-carboxylate?
The InChIKey is LVSJOHGAGNTIHM-AYHJJNSGSA-N. The full InChI is InChI=1S/C22H28FN3O2/c1-14-8-6-10-24-19(14)17-12-16(23)13-18(20-15(2)9-7-11-25-20)26(17)21(27)28-22(3,4)5/h6-11,16-18H,12-13H2,1-5H3/t16?,17-,18+.
What are the key properties of tert-butyl (2R,6S)-4-fluoro-2,6-bis(3-methyl-2-pyridinyl)piperidine-1-carboxylate?
tert-butyl (2R,6S)-4-fluoro-2,6-bis(3-methyl-2-pyridinyl)piperidine-1-carboxylate has a molecular weight of 385.48 g/mol, XLogP of 5.24, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R,6S)-4-fluoro-2,6-bis(3-methyl-2-pyridinyl)piperidine-1-carboxylate is sourced from PubChem (CID 67420335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).