C22H20N4O4 — CID 67420517
4-[2-(ethoxymethyl)-1-(4-nitrophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole (PubChem CID 67420517) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 4-[2-(ethoxymethyl)-1-(4-nitrophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole.
| Compound Name | 4-[2-(ethoxymethyl)-1-(4-nitrophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 67420517 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-[2-(ethoxymethyl)-1-(4-nitrophenyl)imidazol-4-yl]-5-methyl-3-phenyl-1,2-oxazole |
| SMILES | CCOCc1nc(-c2c(-c3ccccc3)noc2C)cn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H20N4O4/c1-3-29-14-20-23-19(13-25(20)17-9-11-18(12-10-17)26(27)28)21-15(2)30-24-22(21)16-7-5-4-6-8-16/h4-13H,3,14H2,1-2H3 |
| InChIKey | VUNDXTKQUGVJTM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 96.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|