About 1-cyclohexa-2,5-dien-1-yl-1-methoxy-4,4-dimethylpentan-2-one
1-cyclohexa-2,5-dien-1-yl-1-methoxy-4,4-dimethylpentan-2-one (PubChem CID 67420936) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-cyclohexa-2,5-dien-1-yl-1-methoxy-4,4-dimethylpentan-2-one.
Molecular Properties
| Compound Name | 1-cyclohexa-2,5-dien-1-yl-1-methoxy-4,4-dimethylpentan-2-one |
| PubChem CID | 67420936 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-cyclohexa-2,5-dien-1-yl-1-methoxy-4,4-dimethylpentan-2-one |
| SMILES | COC(C(=O)CC(C)(C)C)C1C=CCC=C1 |
| InChI | InChI=1S/C14H22O2/c1-14(2,3)10-12(15)13(16-4)11-8-6-5-7-9-11/h6-9,11,13H,5,10H2,1-4H3 |
| InChIKey | YLYJQHRGUJILHN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexa-2,5-dien-1-yl-1-methoxy-4,4-dimethylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-2,5-dien-1-yl-1-methoxy-4,4-dimethylpentan-2-one?
The IUPAC name of 1-cyclohexa-2,5-dien-1-yl-1-methoxy-4,4-dimethylpentan-2-one (CID 67420936) is 1-cyclohexa-2,5-dien-1-yl-1-methoxy-4,4-dimethylpentan-2-one.
What is the SMILES notation for 1-cyclohexa-2,5-dien-1-yl-1-methoxy-4,4-dimethylpentan-2-one?
The canonical SMILES for 1-cyclohexa-2,5-dien-1-yl-1-methoxy-4,4-dimethylpentan-2-one is COC(C(=O)CC(C)(C)C)C1C=CCC=C1.
What is the InChIKey of 1-cyclohexa-2,5-dien-1-yl-1-methoxy-4,4-dimethylpentan-2-one?
The InChIKey is YLYJQHRGUJILHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O2/c1-14(2,3)10-12(15)13(16-4)11-8-6-5-7-9-11/h6-9,11,13H,5,10H2,1-4H3.
What are the key properties of 1-cyclohexa-2,5-dien-1-yl-1-methoxy-4,4-dimethylpentan-2-one?
1-cyclohexa-2,5-dien-1-yl-1-methoxy-4,4-dimethylpentan-2-one has a molecular weight of 222.33 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-2,5-dien-1-yl-1-methoxy-4,4-dimethylpentan-2-one is sourced from PubChem (CID 67420936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).