C29H32N4O3 — CID 67421168
2-[4-[(2S,6R)-4-hydroxy-2,6-bis(3-methyl-2-pyridinyl)piperidin-1-yl]butyl]isoindole-1,3-dione (PubChem CID 67421168) has the molecular formula C29H32N4O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is 2-[4-[(2S,6R)-4-hydroxy-2,6-bis(3-methyl-2-pyridinyl)piperidin-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[(2S,6R)-4-hydroxy-2,6-bis(3-methyl-2-pyridinyl)piperidin-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67421168 |
| Molecular Formula | C29H32N4O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 2-[4-[(2S,6R)-4-hydroxy-2,6-bis(3-methyl-2-pyridinyl)piperidin-1-yl]butyl]isoindole-1,3-dione |
| SMILES | Cc1cccnc1[C@H]1CC(O)C[C@@H](c2ncccc2C)N1CCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H32N4O3/c1-19-9-7-13-30-26(19)24-17-21(34)18-25(27-20(2)10-8-14-31-27)32(24)15-5-6-16-33-28(35)22-11-3-4-12-23(22)29(33)36/h3-4,7-14,21,24-25,34H,5-6,15-18H2,1-2H3/t21?,24-,25+ |
| InChIKey | YLJXPJKVHJLVRA-UYPFPJBKSA-N |
| XLogP | 4.41 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|