About 4-(2,6-dimethylpyrimidin-4-yl)oxycyclohexane-1-carbohydrazide
4-(2,6-dimethylpyrimidin-4-yl)oxycyclohexane-1-carbohydrazide (PubChem CID 67421444) has the molecular formula C13H20N4O2
and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-(2,6-dimethylpyrimidin-4-yl)oxycyclohexane-1-carbohydrazide.
Molecular Properties
| Compound Name | 4-(2,6-dimethylpyrimidin-4-yl)oxycyclohexane-1-carbohydrazide |
| PubChem CID | 67421444 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 4-(2,6-dimethylpyrimidin-4-yl)oxycyclohexane-1-carbohydrazide |
| SMILES | Cc1cc(OC2CCC(C(=O)NN)CC2)nc(C)n1 |
| InChI | InChI=1S/C13H20N4O2/c1-8-7-12(16-9(2)15-8)19-11-5-3-10(4-6-11)13(18)17-14/h7,10-11H,3-6,14H2,1-2H3,(H,17,18) |
| InChIKey | LAFNKASSMUYXLN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,6-dimethylpyrimidin-4-yl)oxycyclohexane-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,6-dimethylpyrimidin-4-yl)oxycyclohexane-1-carbohydrazide?
The IUPAC name of 4-(2,6-dimethylpyrimidin-4-yl)oxycyclohexane-1-carbohydrazide (CID 67421444) is 4-(2,6-dimethylpyrimidin-4-yl)oxycyclohexane-1-carbohydrazide.
What is the SMILES notation for 4-(2,6-dimethylpyrimidin-4-yl)oxycyclohexane-1-carbohydrazide?
The canonical SMILES for 4-(2,6-dimethylpyrimidin-4-yl)oxycyclohexane-1-carbohydrazide is Cc1cc(OC2CCC(C(=O)NN)CC2)nc(C)n1.
What is the InChIKey of 4-(2,6-dimethylpyrimidin-4-yl)oxycyclohexane-1-carbohydrazide?
The InChIKey is LAFNKASSMUYXLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O2/c1-8-7-12(16-9(2)15-8)19-11-5-3-10(4-6-11)13(18)17-14/h7,10-11H,3-6,14H2,1-2H3,(H,17,18).
What are the key properties of 4-(2,6-dimethylpyrimidin-4-yl)oxycyclohexane-1-carbohydrazide?
4-(2,6-dimethylpyrimidin-4-yl)oxycyclohexane-1-carbohydrazide has a molecular weight of 264.33 g/mol, XLogP of 1.02, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6-dimethylpyrimidin-4-yl)oxycyclohexane-1-carbohydrazide is sourced from PubChem (CID 67421444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).