About 4-tert-butyl-6,6-dimethylcyclohexa-1,3-dien-1-ol
4-tert-butyl-6,6-dimethylcyclohexa-1,3-dien-1-ol (PubChem CID 67421653) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is 4-tert-butyl-6,6-dimethylcyclohexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | 4-tert-butyl-6,6-dimethylcyclohexa-1,3-dien-1-ol |
| PubChem CID | 67421653 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 4-tert-butyl-6,6-dimethylcyclohexa-1,3-dien-1-ol |
| SMILES | CC(C)(C)C1=CC=C(O)C(C)(C)C1 |
| InChI | InChI=1S/C12H20O/c1-11(2,3)9-6-7-10(13)12(4,5)8-9/h6-7,13H,8H2,1-5H3 |
| InChIKey | YGYAIQVCAQYTBH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-6,6-dimethylcyclohexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-6,6-dimethylcyclohexa-1,3-dien-1-ol?
The IUPAC name of 4-tert-butyl-6,6-dimethylcyclohexa-1,3-dien-1-ol (CID 67421653) is 4-tert-butyl-6,6-dimethylcyclohexa-1,3-dien-1-ol.
What is the SMILES notation for 4-tert-butyl-6,6-dimethylcyclohexa-1,3-dien-1-ol?
The canonical SMILES for 4-tert-butyl-6,6-dimethylcyclohexa-1,3-dien-1-ol is CC(C)(C)C1=CC=C(O)C(C)(C)C1.
What is the InChIKey of 4-tert-butyl-6,6-dimethylcyclohexa-1,3-dien-1-ol?
The InChIKey is YGYAIQVCAQYTBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O/c1-11(2,3)9-6-7-10(13)12(4,5)8-9/h6-7,13H,8H2,1-5H3.
What are the key properties of 4-tert-butyl-6,6-dimethylcyclohexa-1,3-dien-1-ol?
4-tert-butyl-6,6-dimethylcyclohexa-1,3-dien-1-ol has a molecular weight of 180.29 g/mol, XLogP of 3.83, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-6,6-dimethylcyclohexa-1,3-dien-1-ol is sourced from PubChem (CID 67421653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).