C15H20ClN5O2S — CID 67421855
5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine;hexanoic acid (PubChem CID 67421855) has the molecular formula C15H20ClN5O2S and a molecular weight of 369.88 g/mol. Its IUPAC name is 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine;hexanoic acid.
| Compound Name | 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine;hexanoic acid |
|---|---|
| PubChem CID | 67421855 |
| Molecular Formula | C15H20ClN5O2S |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 5-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3-benzothiadiazol-4-amine;hexanoic acid |
| SMILES | CCCCCC(=O)O.Clc1ccc2nsnc2c1NC1=NCCN1 |
| InChI | InChI=1S/C9H8ClN5S.C6H12O2/c10-5-1-2-6-8(15-16-14-6)7(5)13-9-11-3-4-12-9;1-2-3-4-5-6(7)8/h1-2H,3-4H2,(H2,11,12,13);2-5H2,1H3,(H,7,8) |
| InChIKey | PYPLURBHYMKYQD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|