About 5-amino-2-ethyl-1,3-thiazole-4-carboxylic acid
5-amino-2-ethyl-1,3-thiazole-4-carboxylic acid (PubChem CID 67421917) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is 5-amino-2-ethyl-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-amino-2-ethyl-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 67421917 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 5-amino-2-ethyl-1,3-thiazole-4-carboxylic acid |
| SMILES | CCc1nc(C(=O)O)c(N)s1 |
| InChI | InChI=1S/C6H8N2O2S/c1-2-3-8-4(6(9)10)5(7)11-3/h2,7H2,1H3,(H,9,10) |
| InChIKey | ZSSOPRDKTBJRQJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-2-ethyl-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-ethyl-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-amino-2-ethyl-1,3-thiazole-4-carboxylic acid (CID 67421917) is 5-amino-2-ethyl-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-amino-2-ethyl-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-amino-2-ethyl-1,3-thiazole-4-carboxylic acid is CCc1nc(C(=O)O)c(N)s1.
What is the InChIKey of 5-amino-2-ethyl-1,3-thiazole-4-carboxylic acid?
The InChIKey is ZSSOPRDKTBJRQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-2-3-8-4(6(9)10)5(7)11-3/h2,7H2,1H3,(H,9,10).
What are the key properties of 5-amino-2-ethyl-1,3-thiazole-4-carboxylic acid?
5-amino-2-ethyl-1,3-thiazole-4-carboxylic acid has a molecular weight of 172.21 g/mol, XLogP of 0.99, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-ethyl-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 67421917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).