C31H43N5O3S — CID 67422256
2-[bis(pyridin-2-ylmethyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]undecanamide (PubChem CID 67422256) has the molecular formula C31H43N5O3S and a molecular weight of 565.78 g/mol. Its IUPAC name is 2-[bis(pyridin-2-ylmethyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]undecanamide.
| Compound Name | 2-[bis(pyridin-2-ylmethyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]undecanamide |
|---|---|
| PubChem CID | 67422256 |
| Molecular Formula | C31H43N5O3S |
| Molecular Weight | 565.78 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | 2-[bis(pyridin-2-ylmethyl)amino]-N-[2-(4-sulfamoylphenyl)ethyl]undecanamide |
| SMILES | CCCCCCCCCC(C(=O)NCCc1ccc(S(N)(=O)=O)cc1)N(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C31H43N5O3S/c1-2-3-4-5-6-7-8-15-30(31(37)35-23-20-26-16-18-29(19-17-26)40(32,38)39)36(24-27-13-9-11-21-33-27)25-28-14-10-12-22-34-28/h9-14,16-19,21-22,30H,2-8,15,20,23-25H2,1H3,(H,35,37)(H2,32,38,39) |
| InChIKey | YHWHSCAGWPGOFO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.78 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|