About 3-cyclohexylpyrrole-2,5-dione;1-dodecylpyrrole-2,5-dione
3-cyclohexylpyrrole-2,5-dione;1-dodecylpyrrole-2,5-dione (PubChem CID 67422367) has the molecular formula C26H40N2O4
and a molecular weight of 444.62 g/mol. Its IUPAC name is 3-cyclohexylpyrrole-2,5-dione;1-dodecylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3-cyclohexylpyrrole-2,5-dione;1-dodecylpyrrole-2,5-dione |
| PubChem CID | 67422367 |
| Molecular Formula | C26H40N2O4 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | 3-cyclohexylpyrrole-2,5-dione;1-dodecylpyrrole-2,5-dione |
| SMILES | CCCCCCCCCCCCN1C(=O)C=CC1=O.O=C1C=C(C2CCCCC2)C(=O)N1 |
| InChI | InChI=1S/C16H27NO2.C10H13NO2/c1-2-3-4-5-6-7-8-9-10-11-14-17-15(18)12-13-16(17)19;12-9-6-8(10(13)11-9)7-4-2-1-3-5-7/h12-13H,2-11,14H2,1H3;6-7H,1-5H2,(H,11,12,13) |
| InChIKey | RYCICLOMJNFSSM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclohexylpyrrole-2,5-dione;1-dodecylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylpyrrole-2,5-dione;1-dodecylpyrrole-2,5-dione?
The IUPAC name of 3-cyclohexylpyrrole-2,5-dione;1-dodecylpyrrole-2,5-dione (CID 67422367) is 3-cyclohexylpyrrole-2,5-dione;1-dodecylpyrrole-2,5-dione.
What is the SMILES notation for 3-cyclohexylpyrrole-2,5-dione;1-dodecylpyrrole-2,5-dione?
The canonical SMILES for 3-cyclohexylpyrrole-2,5-dione;1-dodecylpyrrole-2,5-dione is CCCCCCCCCCCCN1C(=O)C=CC1=O.O=C1C=C(C2CCCCC2)C(=O)N1.
What is the InChIKey of 3-cyclohexylpyrrole-2,5-dione;1-dodecylpyrrole-2,5-dione?
The InChIKey is RYCICLOMJNFSSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO2.C10H13NO2/c1-2-3-4-5-6-7-8-9-10-11-14-17-15(18)12-13-16(17)19;12-9-6-8(10(13)11-9)7-4-2-1-3-5-7/h12-13H,2-11,14H2,1H3;6-7H,1-5H2,(H,11,12,13).
What are the key properties of 3-cyclohexylpyrrole-2,5-dione;1-dodecylpyrrole-2,5-dione?
3-cyclohexylpyrrole-2,5-dione;1-dodecylpyrrole-2,5-dione has a molecular weight of 444.62 g/mol, XLogP of 4.98, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylpyrrole-2,5-dione;1-dodecylpyrrole-2,5-dione is sourced from PubChem (CID 67422367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).