About N-ethyl-N-[(3-imidazo[1,2-a]pyrazin-6-ylphenyl)methyl]-3,4-dimethoxyaniline
N-ethyl-N-[(3-imidazo[1,2-a]pyrazin-6-ylphenyl)methyl]-3,4-dimethoxyaniline (PubChem CID 67422487) has the molecular formula C23H24N4O2
and a molecular weight of 388.47 g/mol. Its IUPAC name is N-ethyl-N-[(3-imidazo[1,2-a]pyrazin-6-ylphenyl)methyl]-3,4-dimethoxyaniline.
Molecular Properties
| Compound Name | N-ethyl-N-[(3-imidazo[1,2-a]pyrazin-6-ylphenyl)methyl]-3,4-dimethoxyaniline |
| PubChem CID | 67422487 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-ethyl-N-[(3-imidazo[1,2-a]pyrazin-6-ylphenyl)methyl]-3,4-dimethoxyaniline |
| SMILES | CCN(Cc1cccc(-c2cn3ccnc3cn2)c1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H24N4O2/c1-4-26(19-8-9-21(28-2)22(13-19)29-3)15-17-6-5-7-18(12-17)20-16-27-11-10-24-23(27)14-25-20/h5-14,16H,4,15H2,1-3H3 |
| InChIKey | POFXNIDZBQEWJP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 51.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-[(3-imidazo[1,2-a]pyrazin-6-ylphenyl)methyl]-3,4-dimethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-[(3-imidazo[1,2-a]pyrazin-6-ylphenyl)methyl]-3,4-dimethoxyaniline?
The IUPAC name of N-ethyl-N-[(3-imidazo[1,2-a]pyrazin-6-ylphenyl)methyl]-3,4-dimethoxyaniline (CID 67422487) is N-ethyl-N-[(3-imidazo[1,2-a]pyrazin-6-ylphenyl)methyl]-3,4-dimethoxyaniline.
What is the SMILES notation for N-ethyl-N-[(3-imidazo[1,2-a]pyrazin-6-ylphenyl)methyl]-3,4-dimethoxyaniline?
The canonical SMILES for N-ethyl-N-[(3-imidazo[1,2-a]pyrazin-6-ylphenyl)methyl]-3,4-dimethoxyaniline is CCN(Cc1cccc(-c2cn3ccnc3cn2)c1)c1ccc(OC)c(OC)c1.
What is the InChIKey of N-ethyl-N-[(3-imidazo[1,2-a]pyrazin-6-ylphenyl)methyl]-3,4-dimethoxyaniline?
The InChIKey is POFXNIDZBQEWJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O2/c1-4-26(19-8-9-21(28-2)22(13-19)29-3)15-17-6-5-7-18(12-17)20-16-27-11-10-24-23(27)14-25-20/h5-14,16H,4,15H2,1-3H3.
What are the key properties of N-ethyl-N-[(3-imidazo[1,2-a]pyrazin-6-ylphenyl)methyl]-3,4-dimethoxyaniline?
N-ethyl-N-[(3-imidazo[1,2-a]pyrazin-6-ylphenyl)methyl]-3,4-dimethoxyaniline has a molecular weight of 388.47 g/mol, XLogP of 4.44, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-[(3-imidazo[1,2-a]pyrazin-6-ylphenyl)methyl]-3,4-dimethoxyaniline is sourced from PubChem (CID 67422487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).