About diphenyltin(2+);bis(2-ethylbutan-1-olate)
diphenyltin(2+);bis(2-ethylbutan-1-olate) (PubChem CID 67422574) has the molecular formula C24H36O2Sn
and a molecular weight of 475.26 g/mol. Its IUPAC name is diphenyltin(2+);bis(2-ethylbutan-1-olate).
Molecular Properties
| Compound Name | diphenyltin(2+);bis(2-ethylbutan-1-olate) |
| PubChem CID | 67422574 |
| Molecular Formula | C24H36O2Sn |
| Molecular Weight | 475.26 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | diphenyltin(2+);bis(2-ethylbutan-1-olate) |
| SMILES | CCC(CC)C[O-].CCC(CC)C[O-].c1ccc([Sn+2]c2ccccc2)cc1 |
| InChI | InChI=1S/2C6H13O.2C6H5.Sn/c2*1-3-6(4-2)5-7;2*1-2-4-6-5-3-1;/h2*6H,3-5H2,1-2H3;2*1-5H;/q2*-1;;;+2 |
| InChIKey | BUBNJYGVJSCIGZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 475.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze diphenyltin(2+);bis(2-ethylbutan-1-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyltin(2+);bis(2-ethylbutan-1-olate)?
The IUPAC name of diphenyltin(2+);bis(2-ethylbutan-1-olate) (CID 67422574) is diphenyltin(2+);bis(2-ethylbutan-1-olate).
What is the SMILES notation for diphenyltin(2+);bis(2-ethylbutan-1-olate)?
The canonical SMILES for diphenyltin(2+);bis(2-ethylbutan-1-olate) is CCC(CC)C[O-].CCC(CC)C[O-].c1ccc([Sn+2]c2ccccc2)cc1.
What is the InChIKey of diphenyltin(2+);bis(2-ethylbutan-1-olate)?
The InChIKey is BUBNJYGVJSCIGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H13O.2C6H5.Sn/c2*1-3-6(4-2)5-7;2*1-2-4-6-5-3-1;/h2*6H,3-5H2,1-2H3;2*1-5H;/q2*-1;;;+2.
What are the key properties of diphenyltin(2+);bis(2-ethylbutan-1-olate)?
diphenyltin(2+);bis(2-ethylbutan-1-olate) has a molecular weight of 475.26 g/mol, XLogP of 2.91, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyltin(2+);bis(2-ethylbutan-1-olate) is sourced from PubChem (CID 67422574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).