C16H23NO5 — CID 67422667
2-heptoxy-2-(2-nitrophenyl)-1,3-dioxolane (PubChem CID 67422667) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is 2-heptoxy-2-(2-nitrophenyl)-1,3-dioxolane.
| Compound Name | 2-heptoxy-2-(2-nitrophenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 67422667 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 2-heptoxy-2-(2-nitrophenyl)-1,3-dioxolane |
| SMILES | CCCCCCCOC1(c2ccccc2[N+](=O)[O-])OCCO1 |
| InChI | InChI=1S/C16H23NO5/c1-2-3-4-5-8-11-20-16(21-12-13-22-16)14-9-6-7-10-15(14)17(18)19/h6-7,9-10H,2-5,8,11-13H2,1H3 |
| InChIKey | FNFXUTZOLDCJST-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|