About N-benzyl-1,2-dimethylpyrrolo[2,3-c]pyridin-7-amine
N-benzyl-1,2-dimethylpyrrolo[2,3-c]pyridin-7-amine (PubChem CID 67422882) has the molecular formula C16H17N3
and a molecular weight of 251.33 g/mol. Its IUPAC name is N-benzyl-1,2-dimethylpyrrolo[2,3-c]pyridin-7-amine.
Molecular Properties
| Compound Name | N-benzyl-1,2-dimethylpyrrolo[2,3-c]pyridin-7-amine |
| PubChem CID | 67422882 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N-benzyl-1,2-dimethylpyrrolo[2,3-c]pyridin-7-amine |
| SMILES | Cc1cc2ccnc(NCc3ccccc3)c2n1C |
| InChI | InChI=1S/C16H17N3/c1-12-10-14-8-9-17-16(15(14)19(12)2)18-11-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3,(H,17,18) |
| InChIKey | NMBDZUJOTWYEAV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-1,2-dimethylpyrrolo[2,3-c]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1,2-dimethylpyrrolo[2,3-c]pyridin-7-amine?
The IUPAC name of N-benzyl-1,2-dimethylpyrrolo[2,3-c]pyridin-7-amine (CID 67422882) is N-benzyl-1,2-dimethylpyrrolo[2,3-c]pyridin-7-amine.
What is the SMILES notation for N-benzyl-1,2-dimethylpyrrolo[2,3-c]pyridin-7-amine?
The canonical SMILES for N-benzyl-1,2-dimethylpyrrolo[2,3-c]pyridin-7-amine is Cc1cc2ccnc(NCc3ccccc3)c2n1C.
What is the InChIKey of N-benzyl-1,2-dimethylpyrrolo[2,3-c]pyridin-7-amine?
The InChIKey is NMBDZUJOTWYEAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3/c1-12-10-14-8-9-17-16(15(14)19(12)2)18-11-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3,(H,17,18).
What are the key properties of N-benzyl-1,2-dimethylpyrrolo[2,3-c]pyridin-7-amine?
N-benzyl-1,2-dimethylpyrrolo[2,3-c]pyridin-7-amine has a molecular weight of 251.33 g/mol, XLogP of 3.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1,2-dimethylpyrrolo[2,3-c]pyridin-7-amine is sourced from PubChem (CID 67422882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).