C13H23N5O3 — CID 67423076
2-amino-2-(hydroxymethyl)propane-1,3-diol;N,N-bis(prop-2-enyl)-1,3,5-triazin-2-amine (PubChem CID 67423076) has the molecular formula C13H23N5O3 and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;N,N-bis(prop-2-enyl)-1,3,5-triazin-2-amine.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;N,N-bis(prop-2-enyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 67423076 |
| Molecular Formula | C13H23N5O3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;N,N-bis(prop-2-enyl)-1,3,5-triazin-2-amine |
| SMILES | C=CCN(CC=C)c1ncncn1.NC(CO)(CO)CO |
| InChI | InChI=1S/C9H12N4.C4H11NO3/c1-3-5-13(6-4-2)9-11-7-10-8-12-9;5-4(1-6,2-7)3-8/h3-4,7-8H,1-2,5-6H2;6-8H,1-3,5H2 |
| InChIKey | DMNRKGQTURFAOZ-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|