2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid

C12H20O5 — CID 67423538

IUPAC2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid
SMILESCOC(CC1C(=O)CC[C@H]1C(C)C(=O)O)OC
InChIInChI=1S/C12H20O5/c1-7(12(14)15)8-4-5-10(13)9(8)6-11(16-2)17-3/h7-9,11H,4-6H2,1-3H3,(H,14,15)/t7?,8-,9?/m0/s1
InChIKeyAPLYVVHJQVIQQT-MGURRDGZSA-N
MW244.29 g/mol
LogP1.31
Rot. Bonds6

About 2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid

2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid (PubChem CID 67423538) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid.

Molecular Properties

Compound Name2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid
PubChem CID67423538
Molecular FormulaC12H20O5
Molecular Weight244.29 g/mol
Exact Mass244.13
IUPAC Name2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid
SMILESCOC(CC1C(=O)CC[C@H]1C(C)C(=O)O)OC
InChIInChI=1S/C12H20O5/c1-7(12(14)15)8-4-5-10(13)9(8)6-11(16-2)17-3/h7-9,11H,4-6H2,1-3H3,(H,14,15)/t7?,8-,9?/m0/s1
InChIKeyAPLYVVHJQVIQQT-MGURRDGZSA-N
XLogP1.31
TPSA72.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.29
LogP ≤ 51.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid?
The IUPAC name of 2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid (CID 67423538) is 2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid.
What is the SMILES notation for 2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid?
The canonical SMILES for 2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid is COC(CC1C(=O)CC[C@H]1C(C)C(=O)O)OC.
What is the InChIKey of 2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid?
The InChIKey is APLYVVHJQVIQQT-MGURRDGZSA-N. The full InChI is InChI=1S/C12H20O5/c1-7(12(14)15)8-4-5-10(13)9(8)6-11(16-2)17-3/h7-9,11H,4-6H2,1-3H3,(H,14,15)/t7?,8-,9?/m0/s1.
What are the key properties of 2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid?
2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid has a molecular weight of 244.29 g/mol, XLogP of 1.31, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanoic acid is sourced from PubChem (CID 67423538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).