About dimethyl 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate
dimethyl 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate (PubChem CID 67423893) has the molecular formula C14H22O7
and a molecular weight of 302.32 g/mol. Its IUPAC name is dimethyl 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate |
| PubChem CID | 67423893 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | dimethyl 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C1CCC(=O)C1CC(OC)OC |
| InChI | InChI=1S/C14H22O7/c1-18-11(19-2)7-9-8(5-6-10(9)15)12(13(16)20-3)14(17)21-4/h8-9,11-12H,5-7H2,1-4H3 |
| InChIKey | ZNWNOKDXWOUTBV-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate?
The IUPAC name of dimethyl 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate (CID 67423893) is dimethyl 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate.
What is the SMILES notation for dimethyl 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate?
The canonical SMILES for dimethyl 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate is COC(=O)C(C(=O)OC)C1CCC(=O)C1CC(OC)OC.
What is the InChIKey of dimethyl 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate?
The InChIKey is ZNWNOKDXWOUTBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O7/c1-18-11(19-2)7-9-8(5-6-10(9)15)12(13(16)20-3)14(17)21-4/h8-9,11-12H,5-7H2,1-4H3.
What are the key properties of dimethyl 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate?
dimethyl 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate has a molecular weight of 302.32 g/mol, XLogP of 0.55, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate is sourced from PubChem (CID 67423893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).