About 2-[5-(triazol-2-yl)-2,3-dihydro-1H-inden-1-yl]-2,7-diazaspiro[3.5]nonane
2-[5-(triazol-2-yl)-2,3-dihydro-1H-inden-1-yl]-2,7-diazaspiro[3.5]nonane (PubChem CID 67423981) has the molecular formula C18H23N5
and a molecular weight of 309.42 g/mol. Its IUPAC name is 2-[5-(triazol-2-yl)-2,3-dihydro-1H-inden-1-yl]-2,7-diazaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 2-[5-(triazol-2-yl)-2,3-dihydro-1H-inden-1-yl]-2,7-diazaspiro[3.5]nonane |
| PubChem CID | 67423981 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 2-[5-(triazol-2-yl)-2,3-dihydro-1H-inden-1-yl]-2,7-diazaspiro[3.5]nonane |
| SMILES | c1cnn(-c2ccc3c(c2)CCC3N2CC3(CCNCC3)C2)n1 |
| InChI | InChI=1S/C18H23N5/c1-4-17(22-12-18(13-22)5-7-19-8-6-18)16-3-2-15(11-14(1)16)23-20-9-10-21-23/h2-3,9-11,17,19H,1,4-8,12-13H2 |
| InChIKey | QKZBJZYYGFFGRV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-(triazol-2-yl)-2,3-dihydro-1H-inden-1-yl]-2,7-diazaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(triazol-2-yl)-2,3-dihydro-1H-inden-1-yl]-2,7-diazaspiro[3.5]nonane?
The IUPAC name of 2-[5-(triazol-2-yl)-2,3-dihydro-1H-inden-1-yl]-2,7-diazaspiro[3.5]nonane (CID 67423981) is 2-[5-(triazol-2-yl)-2,3-dihydro-1H-inden-1-yl]-2,7-diazaspiro[3.5]nonane.
What is the SMILES notation for 2-[5-(triazol-2-yl)-2,3-dihydro-1H-inden-1-yl]-2,7-diazaspiro[3.5]nonane?
The canonical SMILES for 2-[5-(triazol-2-yl)-2,3-dihydro-1H-inden-1-yl]-2,7-diazaspiro[3.5]nonane is c1cnn(-c2ccc3c(c2)CCC3N2CC3(CCNCC3)C2)n1.
What is the InChIKey of 2-[5-(triazol-2-yl)-2,3-dihydro-1H-inden-1-yl]-2,7-diazaspiro[3.5]nonane?
The InChIKey is QKZBJZYYGFFGRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N5/c1-4-17(22-12-18(13-22)5-7-19-8-6-18)16-3-2-15(11-14(1)16)23-20-9-10-21-23/h2-3,9-11,17,19H,1,4-8,12-13H2.
What are the key properties of 2-[5-(triazol-2-yl)-2,3-dihydro-1H-inden-1-yl]-2,7-diazaspiro[3.5]nonane?
2-[5-(triazol-2-yl)-2,3-dihydro-1H-inden-1-yl]-2,7-diazaspiro[3.5]nonane has a molecular weight of 309.42 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(triazol-2-yl)-2,3-dihydro-1H-inden-1-yl]-2,7-diazaspiro[3.5]nonane is sourced from PubChem (CID 67423981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).