C14H22O7 — CID 67424170
dimethyl 2-[(1S)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate (PubChem CID 67424170) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is dimethyl 2-[(1S)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate.
| Compound Name | dimethyl 2-[(1S)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate |
|---|---|
| PubChem CID | 67424170 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | dimethyl 2-[(1S)-2-(2,2-dimethoxyethyl)-3-oxocyclopentyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H]1CCC(=O)C1CC(OC)OC |
| InChI | InChI=1S/C14H22O7/c1-18-11(19-2)7-9-8(5-6-10(9)15)12(13(16)20-3)14(17)21-4/h8-9,11-12H,5-7H2,1-4H3/t8-,9?/m0/s1 |
| InChIKey | ZNWNOKDXWOUTBV-IENPIDJESA-N |
| XLogP | 0.55 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|