About 2-[(1S)-2-(2,2-dimethoxyethyl)-1-methyl-3-oxocyclopentyl]-2-methylpropanedioic acid
2-[(1S)-2-(2,2-dimethoxyethyl)-1-methyl-3-oxocyclopentyl]-2-methylpropanedioic acid (PubChem CID 67424171) has the molecular formula C14H22O7
and a molecular weight of 302.32 g/mol. Its IUPAC name is 2-[(1S)-2-(2,2-dimethoxyethyl)-1-methyl-3-oxocyclopentyl]-2-methylpropanedioic acid.
Molecular Properties
| Compound Name | 2-[(1S)-2-(2,2-dimethoxyethyl)-1-methyl-3-oxocyclopentyl]-2-methylpropanedioic acid |
| PubChem CID | 67424171 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-[(1S)-2-(2,2-dimethoxyethyl)-1-methyl-3-oxocyclopentyl]-2-methylpropanedioic acid |
| SMILES | COC(CC1C(=O)CC[C@]1(C)C(C)(C(=O)O)C(=O)O)OC |
| InChI | InChI=1S/C14H22O7/c1-13(14(2,11(16)17)12(18)19)6-5-9(15)8(13)7-10(20-3)21-4/h8,10H,5-7H2,1-4H3,(H,16,17)(H,18,19)/t8?,13-/m0/s1 |
| InChIKey | ROWOCPQNBMKAFD-RLROJCQXSA-N |
| XLogP | 1.16 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S)-2-(2,2-dimethoxyethyl)-1-methyl-3-oxocyclopentyl]-2-methylpropanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S)-2-(2,2-dimethoxyethyl)-1-methyl-3-oxocyclopentyl]-2-methylpropanedioic acid?
The IUPAC name of 2-[(1S)-2-(2,2-dimethoxyethyl)-1-methyl-3-oxocyclopentyl]-2-methylpropanedioic acid (CID 67424171) is 2-[(1S)-2-(2,2-dimethoxyethyl)-1-methyl-3-oxocyclopentyl]-2-methylpropanedioic acid.
What is the SMILES notation for 2-[(1S)-2-(2,2-dimethoxyethyl)-1-methyl-3-oxocyclopentyl]-2-methylpropanedioic acid?
The canonical SMILES for 2-[(1S)-2-(2,2-dimethoxyethyl)-1-methyl-3-oxocyclopentyl]-2-methylpropanedioic acid is COC(CC1C(=O)CC[C@]1(C)C(C)(C(=O)O)C(=O)O)OC.
What is the InChIKey of 2-[(1S)-2-(2,2-dimethoxyethyl)-1-methyl-3-oxocyclopentyl]-2-methylpropanedioic acid?
The InChIKey is ROWOCPQNBMKAFD-RLROJCQXSA-N. The full InChI is InChI=1S/C14H22O7/c1-13(14(2,11(16)17)12(18)19)6-5-9(15)8(13)7-10(20-3)21-4/h8,10H,5-7H2,1-4H3,(H,16,17)(H,18,19)/t8?,13-/m0/s1.
What are the key properties of 2-[(1S)-2-(2,2-dimethoxyethyl)-1-methyl-3-oxocyclopentyl]-2-methylpropanedioic acid?
2-[(1S)-2-(2,2-dimethoxyethyl)-1-methyl-3-oxocyclopentyl]-2-methylpropanedioic acid has a molecular weight of 302.32 g/mol, XLogP of 1.16, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S)-2-(2,2-dimethoxyethyl)-1-methyl-3-oxocyclopentyl]-2-methylpropanedioic acid is sourced from PubChem (CID 67424171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).