C26H45N3O4 — CID 67424704
(3S,3aS,6aR)-2-[2-[(2-amino-2-cyclohexylacetyl)amino]-3,3-dimethylbutanoyl]-3-tert-butyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 67424704) has the molecular formula C26H45N3O4 and a molecular weight of 463.66 g/mol. Its IUPAC name is (3S,3aS,6aR)-2-[2-[(2-amino-2-cyclohexylacetyl)amino]-3,3-dimethylbutanoyl]-3-tert-butyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | (3S,3aS,6aR)-2-[2-[(2-amino-2-cyclohexylacetyl)amino]-3,3-dimethylbutanoyl]-3-tert-butyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 67424704 |
| Molecular Formula | C26H45N3O4 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.34 |
| IUPAC Name | (3S,3aS,6aR)-2-[2-[(2-amino-2-cyclohexylacetyl)amino]-3,3-dimethylbutanoyl]-3-tert-butyl-1,3a,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | CC(C)(C)C(NC(=O)C(N)C1CCCCC1)C(=O)N1C[C@@H]2CCC[C@@H]2[C@@]1(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C26H45N3O4/c1-24(2,3)20(28-21(30)19(27)16-11-8-7-9-12-16)22(31)29-15-17-13-10-14-18(17)26(29,23(32)33)25(4,5)6/h16-20H,7-15,27H2,1-6H3,(H,28,30)(H,32,33)/t17-,18-,19?,20?,26+/m0/s1 |
| InChIKey | SUYHUSVXDBOHKQ-BSLZIJTASA-N |
| XLogP | 3.55 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |