C15H22BrNO2 — CID 67424820
3-(6-amino-5,6,7,8-tetrahydronaphthalen-1-yl)propyl acetate;hydrobromide (PubChem CID 67424820) has the molecular formula C15H22BrNO2 and a molecular weight of 328.25 g/mol. Its IUPAC name is 3-(6-amino-5,6,7,8-tetrahydronaphthalen-1-yl)propyl acetate;hydrobromide.
| Compound Name | 3-(6-amino-5,6,7,8-tetrahydronaphthalen-1-yl)propyl acetate;hydrobromide |
|---|---|
| PubChem CID | 67424820 |
| Molecular Formula | C15H22BrNO2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3-(6-amino-5,6,7,8-tetrahydronaphthalen-1-yl)propyl acetate;hydrobromide |
| SMILES | Br.CC(=O)OCCCc1cccc2c1CCC(N)C2 |
| InChI | InChI=1S/C15H21NO2.BrH/c1-11(17)18-9-3-6-12-4-2-5-13-10-14(16)7-8-15(12)13;/h2,4-5,14H,3,6-10,16H2,1H3;1H |
| InChIKey | JFWIPEQWJBDWLG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|