C30H30Br2O2Si2 — CID 67424912
[(9S,10S)-2,7-dibromo-10-[dimethyl(phenyl)silyl]oxy-9,10-dihydrophenanthren-9-yl]oxy-dimethyl-phenylsilane (PubChem CID 67424912) has the molecular formula C30H30Br2O2Si2 and a molecular weight of 638.55 g/mol. Its IUPAC name is [(9S,10S)-2,7-dibromo-10-[dimethyl(phenyl)silyl]oxy-9,10-dihydrophenanthren-9-yl]oxy-dimethyl-phenylsilane.
| Compound Name | [(9S,10S)-2,7-dibromo-10-[dimethyl(phenyl)silyl]oxy-9,10-dihydrophenanthren-9-yl]oxy-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 67424912 |
| Molecular Formula | C30H30Br2O2Si2 |
| Molecular Weight | 638.55 g/mol |
| Exact Mass | 636.02 |
| IUPAC Name | [(9S,10S)-2,7-dibromo-10-[dimethyl(phenyl)silyl]oxy-9,10-dihydrophenanthren-9-yl]oxy-dimethyl-phenylsilane |
| SMILES | C[Si](C)(O[C@H]1c2cc(Br)ccc2-c2ccc(Br)cc2[C@@H]1O[Si](C)(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H30Br2O2Si2/c1-35(2,23-11-7-5-8-12-23)33-29-27-19-21(31)15-17-25(27)26-18-16-22(32)20-28(26)30(29)34-36(3,4)24-13-9-6-10-14-24/h5-20,29-30H,1-4H3/t29-,30-/m0/s1 |
| InChIKey | CPKJVKMWIXMIDV-KYJUHHDHSA-N |
| XLogP | 8.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.55 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|