About (4,5-dibromothiophen-2-yl) ethyl carbonate
(4,5-dibromothiophen-2-yl) ethyl carbonate (PubChem CID 67425091) has the molecular formula C7H6Br2O3S
and a molecular weight of 330.00 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl) ethyl carbonate.
Molecular Properties
| Compound Name | (4,5-dibromothiophen-2-yl) ethyl carbonate |
| PubChem CID | 67425091 |
| Molecular Formula | C7H6Br2O3S |
| Molecular Weight | 330.00 g/mol |
| Exact Mass | 327.84 |
| IUPAC Name | (4,5-dibromothiophen-2-yl) ethyl carbonate |
| SMILES | CCOC(=O)Oc1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C7H6Br2O3S/c1-2-11-7(10)12-5-3-4(8)6(9)13-5/h3H,2H2,1H3 |
| InChIKey | SLYWRAKAGFIAOT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.00 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4,5-dibromothiophen-2-yl) ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dibromothiophen-2-yl) ethyl carbonate?
The IUPAC name of (4,5-dibromothiophen-2-yl) ethyl carbonate (CID 67425091) is (4,5-dibromothiophen-2-yl) ethyl carbonate.
What is the SMILES notation for (4,5-dibromothiophen-2-yl) ethyl carbonate?
The canonical SMILES for (4,5-dibromothiophen-2-yl) ethyl carbonate is CCOC(=O)Oc1cc(Br)c(Br)s1.
What is the InChIKey of (4,5-dibromothiophen-2-yl) ethyl carbonate?
The InChIKey is SLYWRAKAGFIAOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Br2O3S/c1-2-11-7(10)12-5-3-4(8)6(9)13-5/h3H,2H2,1H3.
What are the key properties of (4,5-dibromothiophen-2-yl) ethyl carbonate?
(4,5-dibromothiophen-2-yl) ethyl carbonate has a molecular weight of 330.00 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dibromothiophen-2-yl) ethyl carbonate is sourced from PubChem (CID 67425091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).