C32H35F3N2O5 — CID 67425589
[1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate;2,2,2-trifluoroacetate (PubChem CID 67425589) has the molecular formula C32H35F3N2O5 and a molecular weight of 584.64 g/mol. Its IUPAC name is [1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate;2,2,2-trifluoroacetate.
| Compound Name | [1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67425589 |
| Molecular Formula | C32H35F3N2O5 |
| Molecular Weight | 584.64 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | [1-(3-phenoxypropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-anilino-2-phenylacetate;2,2,2-trifluoroacetate |
| SMILES | O=C(OC1C[N+]2(CCCOc3ccccc3)CCC1CC2)C(Nc1ccccc1)c1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C30H35N2O3.C2HF3O2/c33-30(29(25-11-4-1-5-12-25)31-26-13-6-2-7-14-26)35-28-23-32(20-17-24(28)18-21-32)19-10-22-34-27-15-8-3-9-16-27;3-2(4,5)1(6)7/h1-9,11-16,24,28-29,31H,10,17-23H2;(H,6,7)/q+1;/p-1 |
| InChIKey | PAQQMVJKSSWBFC-UHFFFAOYSA-M |
| XLogP | 4.76 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.64 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|