About 2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole
2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 674261) has the molecular formula C13H16N2
and a molecular weight of 200.29 g/mol. Its IUPAC name is 2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole.
Molecular Properties
| Compound Name | 2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| PubChem CID | 674261 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | CN1CCc2c(c3ccccc3n2C)C1 |
| InChI | InChI=1S/C13H16N2/c1-14-8-7-13-11(9-14)10-5-3-4-6-12(10)15(13)2/h3-6H,7-9H2,1-2H3 |
| InChIKey | JHIOFDRUJGJPFN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole?
The IUPAC name of 2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole (CID 674261) is 2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole.
What is the SMILES notation for 2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole?
The canonical SMILES for 2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole is CN1CCc2c(c3ccccc3n2C)C1.
What is the InChIKey of 2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole?
The InChIKey is JHIOFDRUJGJPFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-14-8-7-13-11(9-14)10-5-3-4-6-12(10)15(13)2/h3-6H,7-9H2,1-2H3.
What are the key properties of 2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole?
2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole has a molecular weight of 200.29 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole is sourced from PubChem (CID 674261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).