About 3-(3H-imidazo[4,5-c]pyridin-2-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine
3-(3H-imidazo[4,5-c]pyridin-2-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine (PubChem CID 67426234) has the molecular formula C17H14N6O2S
and a molecular weight of 366.41 g/mol. Its IUPAC name is 3-(3H-imidazo[4,5-c]pyridin-2-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-(3H-imidazo[4,5-c]pyridin-2-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine |
| PubChem CID | 67426234 |
| Molecular Formula | C17H14N6O2S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 3-(3H-imidazo[4,5-c]pyridin-2-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine |
| SMILES | CS(=O)(=O)c1ccc(-c2cnc(N)c(-c3nc4ccncc4[nH]3)n2)cc1 |
| InChI | InChI=1S/C17H14N6O2S/c1-26(24,25)11-4-2-10(3-5-11)13-9-20-16(18)15(21-13)17-22-12-6-7-19-8-14(12)23-17/h2-9H,1H3,(H2,18,20)(H,22,23) |
| InChIKey | QKMHLNDQJMBTJW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(3H-imidazo[4,5-c]pyridin-2-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3H-imidazo[4,5-c]pyridin-2-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine?
The IUPAC name of 3-(3H-imidazo[4,5-c]pyridin-2-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine (CID 67426234) is 3-(3H-imidazo[4,5-c]pyridin-2-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine.
What is the SMILES notation for 3-(3H-imidazo[4,5-c]pyridin-2-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine?
The canonical SMILES for 3-(3H-imidazo[4,5-c]pyridin-2-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine is CS(=O)(=O)c1ccc(-c2cnc(N)c(-c3nc4ccncc4[nH]3)n2)cc1.
What is the InChIKey of 3-(3H-imidazo[4,5-c]pyridin-2-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine?
The InChIKey is QKMHLNDQJMBTJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N6O2S/c1-26(24,25)11-4-2-10(3-5-11)13-9-20-16(18)15(21-13)17-22-12-6-7-19-8-14(12)23-17/h2-9H,1H3,(H2,18,20)(H,22,23).
What are the key properties of 3-(3H-imidazo[4,5-c]pyridin-2-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine?
3-(3H-imidazo[4,5-c]pyridin-2-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine has a molecular weight of 366.41 g/mol, XLogP of 2.07, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3H-imidazo[4,5-c]pyridin-2-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine is sourced from PubChem (CID 67426234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).