C22H29N5O3 — CID 67426275
methyl (5S,7aR)-3a-methyl-5-[methyl-(1-methyl-6-oxo-4-pyridin-4-ylpyrimidin-2-yl)amino]-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate (PubChem CID 67426275) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is methyl (5S,7aR)-3a-methyl-5-[methyl-(1-methyl-6-oxo-4-pyridin-4-ylpyrimidin-2-yl)amino]-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate.
| Compound Name | methyl (5S,7aR)-3a-methyl-5-[methyl-(1-methyl-6-oxo-4-pyridin-4-ylpyrimidin-2-yl)amino]-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate |
|---|---|
| PubChem CID | 67426275 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | methyl (5S,7aR)-3a-methyl-5-[methyl-(1-methyl-6-oxo-4-pyridin-4-ylpyrimidin-2-yl)amino]-3,4,5,6,7,7a-hexahydro-2H-indole-1-carboxylate |
| SMILES | COC(=O)N1CCC2(C)C[C@@H](N(C)c3nc(-c4ccncc4)cc(=O)n3C)CC[C@@H]12 |
| InChI | InChI=1S/C22H29N5O3/c1-22-9-12-27(21(29)30-4)18(22)6-5-16(14-22)25(2)20-24-17(13-19(28)26(20)3)15-7-10-23-11-8-15/h7-8,10-11,13,16,18H,5-6,9,12,14H2,1-4H3/t16-,18+,22?/m0/s1 |
| InChIKey | XYAIYUFLUOBVDE-OATREDKOSA-N |
| XLogP | 2.68 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |