C10H20N2O3 — CID 67426496
[(3S,4S)-3-hydroxy-1-(2-methylpropyl)piperidin-4-yl] carbamate (PubChem CID 67426496) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is [(3S,4S)-3-hydroxy-1-(2-methylpropyl)piperidin-4-yl] carbamate.
| Compound Name | [(3S,4S)-3-hydroxy-1-(2-methylpropyl)piperidin-4-yl] carbamate |
|---|---|
| PubChem CID | 67426496 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | [(3S,4S)-3-hydroxy-1-(2-methylpropyl)piperidin-4-yl] carbamate |
| SMILES | CC(C)CN1CC[C@H](OC(N)=O)[C@@H](O)C1 |
| InChI | InChI=1S/C10H20N2O3/c1-7(2)5-12-4-3-9(8(13)6-12)15-10(11)14/h7-9,13H,3-6H2,1-2H3,(H2,11,14)/t8-,9-/m0/s1 |
| InChIKey | AOLFSEJQYQMJLW-IUCAKERBSA-N |
| XLogP | 0.17 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |