C12H13NO2S — CID 67426658
2-cyclohexa-2,4-dien-1-ylbenzenesulfonamide (PubChem CID 67426658) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-ylbenzenesulfonamide.
| Compound Name | 2-cyclohexa-2,4-dien-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 67426658 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-ylbenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1C1C=CC=CC1 |
| InChI | InChI=1S/C12H13NO2S/c13-16(14,15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-6,8-10H,7H2,(H2,13,14,15) |
| InChIKey | QCMGXZZAHWZOCH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |