C27H28F3N3O2S+2 — CID 67426867
1-benzyl-4-[1-(2,4,6-trimethylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium;trifluoromethanesulfonamide (PubChem CID 67426867) has the molecular formula C27H28F3N3O2S+2 and a molecular weight of 515.60 g/mol. Its IUPAC name is 1-benzyl-4-[1-(2,4,6-trimethylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium;trifluoromethanesulfonamide.
| Compound Name | 1-benzyl-4-[1-(2,4,6-trimethylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium;trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 67426867 |
| Molecular Formula | C27H28F3N3O2S+2 |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 1-benzyl-4-[1-(2,4,6-trimethylphenyl)pyridin-1-ium-4-yl]pyridin-1-ium;trifluoromethanesulfonamide |
| SMILES | Cc1cc(C)c(-[n+]2ccc(-c3cc[n+](Cc4ccccc4)cc3)cc2)c(C)c1.NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C26H26N2.CH2F3NO2S/c1-20-17-21(2)26(22(3)18-20)28-15-11-25(12-16-28)24-9-13-27(14-10-24)19-23-7-5-4-6-8-23;2-1(3,4)8(5,6)7/h4-18H,19H2,1-3H3;(H2,5,6,7)/q+2; |
| InChIKey | VRJUCGFXJSJWIC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|