About 2-[1-(1,2-dihydropyridin-2-yl)decyl]-1,2-dihydropyridine
2-[1-(1,2-dihydropyridin-2-yl)decyl]-1,2-dihydropyridine (PubChem CID 67427103) has the molecular formula C20H32N2
and a molecular weight of 300.49 g/mol. Its IUPAC name is 2-[1-(1,2-dihydropyridin-2-yl)decyl]-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2-[1-(1,2-dihydropyridin-2-yl)decyl]-1,2-dihydropyridine |
| PubChem CID | 67427103 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | 2-[1-(1,2-dihydropyridin-2-yl)decyl]-1,2-dihydropyridine |
| SMILES | CCCCCCCCCC(C1C=CC=CN1)C1C=CC=CN1 |
| InChI | InChI=1S/C20H32N2/c1-2-3-4-5-6-7-8-13-18(19-14-9-11-16-21-19)20-15-10-12-17-22-20/h9-12,14-22H,2-8,13H2,1H3 |
| InChIKey | YXVQPWPRDCAWBT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(1,2-dihydropyridin-2-yl)decyl]-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(1,2-dihydropyridin-2-yl)decyl]-1,2-dihydropyridine?
The IUPAC name of 2-[1-(1,2-dihydropyridin-2-yl)decyl]-1,2-dihydropyridine (CID 67427103) is 2-[1-(1,2-dihydropyridin-2-yl)decyl]-1,2-dihydropyridine.
What is the SMILES notation for 2-[1-(1,2-dihydropyridin-2-yl)decyl]-1,2-dihydropyridine?
The canonical SMILES for 2-[1-(1,2-dihydropyridin-2-yl)decyl]-1,2-dihydropyridine is CCCCCCCCCC(C1C=CC=CN1)C1C=CC=CN1.
What is the InChIKey of 2-[1-(1,2-dihydropyridin-2-yl)decyl]-1,2-dihydropyridine?
The InChIKey is YXVQPWPRDCAWBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32N2/c1-2-3-4-5-6-7-8-13-18(19-14-9-11-16-21-19)20-15-10-12-17-22-20/h9-12,14-22H,2-8,13H2,1H3.
What are the key properties of 2-[1-(1,2-dihydropyridin-2-yl)decyl]-1,2-dihydropyridine?
2-[1-(1,2-dihydropyridin-2-yl)decyl]-1,2-dihydropyridine has a molecular weight of 300.49 g/mol, XLogP of 4.83, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(1,2-dihydropyridin-2-yl)decyl]-1,2-dihydropyridine is sourced from PubChem (CID 67427103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).