About 5-(chloromethyl)-1,3-difluoro-2-propan-2-yloxybenzene
5-(chloromethyl)-1,3-difluoro-2-propan-2-yloxybenzene (PubChem CID 67427354) has the molecular formula C10H11ClF2O
and a molecular weight of 220.65 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-difluoro-2-propan-2-yloxybenzene.
Molecular Properties
| Compound Name | 5-(chloromethyl)-1,3-difluoro-2-propan-2-yloxybenzene |
| PubChem CID | 67427354 |
| Molecular Formula | C10H11ClF2O |
| Molecular Weight | 220.65 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 5-(chloromethyl)-1,3-difluoro-2-propan-2-yloxybenzene |
| SMILES | CC(C)Oc1c(F)cc(CCl)cc1F |
| InChI | InChI=1S/C10H11ClF2O/c1-6(2)14-10-8(12)3-7(5-11)4-9(10)13/h3-4,6H,5H2,1-2H3 |
| InChIKey | JWKCJLAIWQGJJA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.65 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-1,3-difluoro-2-propan-2-yloxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-1,3-difluoro-2-propan-2-yloxybenzene?
The IUPAC name of 5-(chloromethyl)-1,3-difluoro-2-propan-2-yloxybenzene (CID 67427354) is 5-(chloromethyl)-1,3-difluoro-2-propan-2-yloxybenzene.
What is the SMILES notation for 5-(chloromethyl)-1,3-difluoro-2-propan-2-yloxybenzene?
The canonical SMILES for 5-(chloromethyl)-1,3-difluoro-2-propan-2-yloxybenzene is CC(C)Oc1c(F)cc(CCl)cc1F.
What is the InChIKey of 5-(chloromethyl)-1,3-difluoro-2-propan-2-yloxybenzene?
The InChIKey is JWKCJLAIWQGJJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClF2O/c1-6(2)14-10-8(12)3-7(5-11)4-9(10)13/h3-4,6H,5H2,1-2H3.
What are the key properties of 5-(chloromethyl)-1,3-difluoro-2-propan-2-yloxybenzene?
5-(chloromethyl)-1,3-difluoro-2-propan-2-yloxybenzene has a molecular weight of 220.65 g/mol, XLogP of 3.49, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-1,3-difluoro-2-propan-2-yloxybenzene is sourced from PubChem (CID 67427354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).