C6H10N4 — CID 67427436
2-methyl-2,3,4,7-tetrahydro-1H-purine (PubChem CID 67427436) has the molecular formula C6H10N4 and a molecular weight of 138.17 g/mol. Its IUPAC name is 2-methyl-2,3,4,7-tetrahydro-1H-purine.
| Compound Name | 2-methyl-2,3,4,7-tetrahydro-1H-purine |
|---|---|
| PubChem CID | 67427436 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 2-methyl-2,3,4,7-tetrahydro-1H-purine |
| SMILES | CC1NC=C2NC=NC2N1 |
| InChI | InChI=1S/C6H10N4/c1-4-7-2-5-6(10-4)9-3-8-5/h2-4,6-7,10H,1H3,(H,8,9) |
| InChIKey | ZKXSRSWURGQWLC-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |