About 3-(2-fluoro-N-methyl-3,4-diphenylanilino)propan-1-ol
3-(2-fluoro-N-methyl-3,4-diphenylanilino)propan-1-ol (PubChem CID 67427498) has the molecular formula C22H22FNO
and a molecular weight of 335.42 g/mol. Its IUPAC name is 3-(2-fluoro-N-methyl-3,4-diphenylanilino)propan-1-ol.
Molecular Properties
| Compound Name | 3-(2-fluoro-N-methyl-3,4-diphenylanilino)propan-1-ol |
| PubChem CID | 67427498 |
| Molecular Formula | C22H22FNO |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 3-(2-fluoro-N-methyl-3,4-diphenylanilino)propan-1-ol |
| SMILES | CN(CCCO)c1ccc(-c2ccccc2)c(-c2ccccc2)c1F |
| InChI | InChI=1S/C22H22FNO/c1-24(15-8-16-25)20-14-13-19(17-9-4-2-5-10-17)21(22(20)23)18-11-6-3-7-12-18/h2-7,9-14,25H,8,15-16H2,1H3 |
| InChIKey | OZRRNMOURLWFGL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-fluoro-N-methyl-3,4-diphenylanilino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-fluoro-N-methyl-3,4-diphenylanilino)propan-1-ol?
The IUPAC name of 3-(2-fluoro-N-methyl-3,4-diphenylanilino)propan-1-ol (CID 67427498) is 3-(2-fluoro-N-methyl-3,4-diphenylanilino)propan-1-ol.
What is the SMILES notation for 3-(2-fluoro-N-methyl-3,4-diphenylanilino)propan-1-ol?
The canonical SMILES for 3-(2-fluoro-N-methyl-3,4-diphenylanilino)propan-1-ol is CN(CCCO)c1ccc(-c2ccccc2)c(-c2ccccc2)c1F.
What is the InChIKey of 3-(2-fluoro-N-methyl-3,4-diphenylanilino)propan-1-ol?
The InChIKey is OZRRNMOURLWFGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22FNO/c1-24(15-8-16-25)20-14-13-19(17-9-4-2-5-10-17)21(22(20)23)18-11-6-3-7-12-18/h2-7,9-14,25H,8,15-16H2,1H3.
What are the key properties of 3-(2-fluoro-N-methyl-3,4-diphenylanilino)propan-1-ol?
3-(2-fluoro-N-methyl-3,4-diphenylanilino)propan-1-ol has a molecular weight of 335.42 g/mol, XLogP of 4.98, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-fluoro-N-methyl-3,4-diphenylanilino)propan-1-ol is sourced from PubChem (CID 67427498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).