About 3-amino-5,6-dimethylpyridazine-4-carboxamide
3-amino-5,6-dimethylpyridazine-4-carboxamide (PubChem CID 67427894) has the molecular formula C7H10N4O
and a molecular weight of 166.18 g/mol. Its IUPAC name is 3-amino-5,6-dimethylpyridazine-4-carboxamide.
Molecular Properties
| Compound Name | 3-amino-5,6-dimethylpyridazine-4-carboxamide |
| PubChem CID | 67427894 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 3-amino-5,6-dimethylpyridazine-4-carboxamide |
| SMILES | Cc1nnc(N)c(C(N)=O)c1C |
| InChI | InChI=1S/C7H10N4O/c1-3-4(2)10-11-6(8)5(3)7(9)12/h1-2H3,(H2,8,11)(H2,9,12) |
| InChIKey | AQBMDBOPDQHBTB-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-5,6-dimethylpyridazine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5,6-dimethylpyridazine-4-carboxamide?
The IUPAC name of 3-amino-5,6-dimethylpyridazine-4-carboxamide (CID 67427894) is 3-amino-5,6-dimethylpyridazine-4-carboxamide.
What is the SMILES notation for 3-amino-5,6-dimethylpyridazine-4-carboxamide?
The canonical SMILES for 3-amino-5,6-dimethylpyridazine-4-carboxamide is Cc1nnc(N)c(C(N)=O)c1C.
What is the InChIKey of 3-amino-5,6-dimethylpyridazine-4-carboxamide?
The InChIKey is AQBMDBOPDQHBTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O/c1-3-4(2)10-11-6(8)5(3)7(9)12/h1-2H3,(H2,8,11)(H2,9,12).
What are the key properties of 3-amino-5,6-dimethylpyridazine-4-carboxamide?
3-amino-5,6-dimethylpyridazine-4-carboxamide has a molecular weight of 166.18 g/mol, XLogP of -0.23, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5,6-dimethylpyridazine-4-carboxamide is sourced from PubChem (CID 67427894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).