C20H28O3 — CID 67428000
(2R,3R,4R)-2-benzyl-4-hydroxy-3-(1-hydroxyoct-1-enyl)cyclopentan-1-one (PubChem CID 67428000) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (2R,3R,4R)-2-benzyl-4-hydroxy-3-(1-hydroxyoct-1-enyl)cyclopentan-1-one.
| Compound Name | (2R,3R,4R)-2-benzyl-4-hydroxy-3-(1-hydroxyoct-1-enyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 67428000 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (2R,3R,4R)-2-benzyl-4-hydroxy-3-(1-hydroxyoct-1-enyl)cyclopentan-1-one |
| SMILES | CCCCCCC=C(O)[C@H]1[C@H](O)CC(=O)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C20H28O3/c1-2-3-4-5-9-12-17(21)20-16(18(22)14-19(20)23)13-15-10-7-6-8-11-15/h6-8,10-12,16,19-21,23H,2-5,9,13-14H2,1H3/t16-,19+,20-/m0/s1 |
| InChIKey | BAWXCZSSPXPEEA-DBVUQKKJSA-N |
| XLogP | 4.21 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|